![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
2nd Heat | 20-Apr-2018 16:20 | - | |
|
A.C. Ming | 20-Apr-2018 16:20 | - | |
|
A.R.S. | 20-Apr-2018 16:20 | - | |
|
Aaron Mellinger | 20-Apr-2018 16:20 | - | |
|
Absorber | 20-Apr-2018 16:20 | - | |
|
Acephala | 20-Apr-2018 16:20 | - | |
|
Achille Lauro | 20-Apr-2018 16:20 | - | |
|
Action Toolbelt | 20-Apr-2018 16:20 | - | |
|
Adios Pantalones | 20-Apr-2018 16:20 | - | |
|
Akari Kaida & Hideki Okugawa & Kouta Suzuki | 20-Apr-2018 16:20 | - | |
|
Al Caiola's Magic Guitars | 20-Apr-2018 16:20 | - | |
|
Alasdair Fraser | 20-Apr-2018 16:20 | - | |
|
Alberta | 20-Apr-2018 16:20 | - | |
|
Alexander Rybak & Paula Seling | 20-Apr-2018 16:20 | - | |
|
All Souls' Day | 20-Apr-2018 16:20 | - | |
|
Allison Williams | 20-Apr-2018 16:20 | - | |
|
Amie Moore | 20-Apr-2018 16:20 | - | |
|
Andersen | 20-Apr-2018 16:20 | - | |
|
Applecore | 20-Apr-2018 16:20 | - | |
|
Arijskij Sturm | 20-Apr-2018 16:20 | - | |
|
Art in America | 20-Apr-2018 16:20 | - | |
|
Arty Smokes | 20-Apr-2018 16:20 | - | |
|
Astaroth | 20-Apr-2018 16:20 | - | |
|
Astral Body | 20-Apr-2018 16:20 | - | |
|
Asymmetrical Head | 20-Apr-2018 16:20 | - | |
|
Atoosa | 20-Apr-2018 16:20 | - | |
|
Austin Hartley-Leonard & Kendall Jane Meade | 20-Apr-2018 16:20 | - | |
|
Avner and Rachel Boskey | 20-Apr-2018 16:20 | - | |
|
BASS TALK | 20-Apr-2018 16:20 | - | |
|
Banda Betamax | 20-Apr-2018 16:20 | - | |
|
Bartmes | 20-Apr-2018 16:20 | - | |
|
Bassapadana | 20-Apr-2018 16:20 | - | |
|
Behold! The Living Corpse | 20-Apr-2018 16:20 | - | |
|
Besser | 20-Apr-2018 16:20 | - | |
|
Beto Quintanilla | 20-Apr-2018 16:20 | - | |
|
Big Time Rush feat. Snoop Dogg | 20-Apr-2018 16:20 | - | |
|
Big Time Sarah and the BTS Express | 20-Apr-2018 16:20 | - | |
|
Blitzkrier | 20-Apr-2018 16:20 | - | |
|
Break Me Completely | 20-Apr-2018 16:20 | - | |
|
Brigitte Fontaine & Khan | 20-Apr-2018 16:20 | - | |
|
Broadcast Oblivion | 20-Apr-2018 16:20 | - | |
|
By the Grace of God | 20-Apr-2018 16:20 | - | |
|
C-Rom | 20-Apr-2018 16:20 | - | |
|
Caché Juncal | 20-Apr-2018 16:20 | - | |
|
Cara Dillon & John Smith | 20-Apr-2018 16:20 | - | |
|
Casey Collins | 20-Apr-2018 16:20 | - | |
|
Catherine Bott | 20-Apr-2018 16:20 | - | |
|
Ceoltóirí Cultúrlainne | 20-Apr-2018 16:20 | - | |
|
Chalmers Davis | 20-Apr-2018 16:20 | - | |
|
Charles Davis | 20-Apr-2018 16:20 | - | |
|
Charlie Haden & Carla Bley | 20-Apr-2018 16:20 | - | |
|
Chris Burke | 20-Apr-2018 16:20 | - | |
|
Coen Vermeeren | 20-Apr-2018 16:20 | - | |
|
Con Hunley | 20-Apr-2018 16:20 | - | |
|
Contact | 20-Apr-2018 16:20 | - | |
|
Crazy Pink Revolvers | 20-Apr-2018 16:20 | - | |
|
Crivits | 20-Apr-2018 16:20 | - | |
|
Crystal Swing | 20-Apr-2018 16:20 | - | |
|
DLS | 20-Apr-2018 16:20 | - | |
|
Damiens | 20-Apr-2018 16:20 | - | |
|
Daniel Merriweather feat. Adele | 20-Apr-2018 16:20 | - | |
|
Danny Carnahan & Robin Petrie | 20-Apr-2018 16:20 | - | |
|
Danny Chambers | 20-Apr-2018 16:20 | - | |
|
Darol Anger's Republic of Strings | 20-Apr-2018 16:20 | - | |
|
Dave Holland Sextet | 20-Apr-2018 16:20 | - | |
|
David Motion | 20-Apr-2018 16:20 | - | |
|
Davo | 20-Apr-2018 16:20 | - | |
|
Dazeafter | 20-Apr-2018 16:20 | - | |
|
De Mounties | 20-Apr-2018 16:20 | - | |
|
Deeyah | 20-Apr-2018 16:20 | - | |
|
Der Gerwelt | 20-Apr-2018 16:20 | - | |
|
Die zwangsversteigerten Doppelhaushälften | 20-Apr-2018 16:20 | - | |
|
Dieter Süverkrüp & Walter Andreas Schwarz | 20-Apr-2018 16:20 | - | |
|
Dodge City Productions feat. Ghida de Palma | 20-Apr-2018 16:20 | - | |
|
Dolfinesque | 20-Apr-2018 16:20 | - | |
|
Drop Out City Rockers | 20-Apr-2018 16:20 | - | |
|
DukeDaGod | 20-Apr-2018 16:20 | - | |
|
E.V.A. | 20-Apr-2018 16:20 | - | |
|
E.X.I.T. | 20-Apr-2018 16:20 | - | |
|
ETS | 20-Apr-2018 16:20 | - | |
|
Echophonic | 20-Apr-2018 16:20 | - | |
|
Edgar Guererro | 20-Apr-2018 16:20 | - | |
|
Enrique Del Pozo | 20-Apr-2018 16:20 | - | |
|
Errol Dixon | 20-Apr-2018 16:20 | - | |
|
Eryck Abecassis | 20-Apr-2018 16:20 | - | |
|
Explicit Samouraï | 20-Apr-2018 16:20 | - | |
|
Eye Knife | 20-Apr-2018 16:20 | - | |
|
Fidbek | 20-Apr-2018 16:20 | - | |
|
Fisk Industries | 20-Apr-2018 16:20 | - | |
|
Five Star Prison Cell | 20-Apr-2018 16:20 | - | |
|
FlyEr | 20-Apr-2018 16:20 | - | |
|
Foul Stench | 20-Apr-2018 16:20 | - | |
|
Gaia | 20-Apr-2018 16:20 | - | |
|
Galactik Knights | 20-Apr-2018 16:20 | - | |
|
GlassHeads | 20-Apr-2018 16:20 | - | |
|
Glenn Gulli | 20-Apr-2018 16:20 | - | |
|
Gobodobro | 20-Apr-2018 16:20 | - | |
|
Greg Baumont | 20-Apr-2018 16:20 | - | |
|
Greg Greene | 20-Apr-2018 16:20 | - | |
|
Grupo Vou Vivendo | 20-Apr-2018 16:20 | - | |
|
Hail Social | 20-Apr-2018 16:20 | - | |
|
Hank Shizzoe & Loose Gravel | 20-Apr-2018 16:20 | - | |
|
Haruko Nara | 20-Apr-2018 16:20 | - | |
|
Headbanger | 20-Apr-2018 16:20 | - | |
|
Hemi | 20-Apr-2018 16:20 | - | |
|
Hinsides | 20-Apr-2018 16:20 | - | |
|
Hospital | 20-Apr-2018 16:20 | - | |
|
Human Disease | 20-Apr-2018 16:20 | - | |
|
Il Berlione | 20-Apr-2018 16:20 | - | |
|
Ilkka Rantamäki | 20-Apr-2018 16:20 | - | |
|
Impure Domain | 20-Apr-2018 16:20 | - | |
|
Inner Strength | 20-Apr-2018 16:20 | - | |
|
Jasco | 20-Apr-2018 16:20 | - | |
|
Jef der Dood | 20-Apr-2018 16:20 | - | |
|
Jerry Jaye | 20-Apr-2018 16:20 | - | |
|
Jimmy Riley | 20-Apr-2018 16:20 | - | |
|
Joelle Léandre & Anne Montaron | 20-Apr-2018 16:20 | - | |
|
Johannes Rasmussen | 20-Apr-2018 16:20 | - | |
|
John Lee | 20-Apr-2018 16:20 | - | |
|
John Pizzarelli with The George Shearing Quintet | 20-Apr-2018 16:20 | - | |
|
John Voorhees | 20-Apr-2018 16:20 | - | |
|
Joshua Jones | 20-Apr-2018 16:20 | - | |
|
José de Arimatéia Santos | 20-Apr-2018 16:20 | - | |
|
Kangta & Vanness | 20-Apr-2018 16:20 | - | |
|
Khmer Rouge | 20-Apr-2018 16:20 | - | |
|
King Mungi | 20-Apr-2018 16:20 | - | |
|
Knossos | 20-Apr-2018 16:20 | - | |
|
Käärkäsi | 20-Apr-2018 16:20 | - | |
|
La plebe | 20-Apr-2018 16:20 | - | |
|
Lars Reichow | 20-Apr-2018 16:20 | - | |
|
Laura Mardon | 20-Apr-2018 16:20 | - | |
|
Le Trio Joubran | 20-Apr-2018 16:20 | - | |
|
Lean Boyz | 20-Apr-2018 16:20 | - | |
|
Left Front Tire | 20-Apr-2018 16:20 | - | |
|
Leftnutt | 20-Apr-2018 16:20 | - | |
|
Les Cosaques | 20-Apr-2018 16:20 | - | |
|
Les Freres Courvoisier | 20-Apr-2018 16:20 | - | |
|
Living Chivalry | 20-Apr-2018 16:20 | - | |
|
Locked Together In Hatred | 20-Apr-2018 16:20 | - | |
|
Los Mitos | 20-Apr-2018 16:20 | - | |
|
Lugano Fell | 20-Apr-2018 16:20 | - | |
|
LéOparleur | 20-Apr-2018 16:20 | - | |
|
Malena Burke y NG La Banda | 20-Apr-2018 16:20 | - | |
|
Mark Teijgeler | 20-Apr-2018 16:20 | - | |
|
Masterfleet | 20-Apr-2018 16:20 | - | |
|
Masters of Ceremony | 20-Apr-2018 16:20 | - | |
|
Matt Coldrick & Matt Hillier | 20-Apr-2018 16:20 | - | |
|
Max Gruzin | 20-Apr-2018 16:20 | - | |
|
Maximus 3 | 20-Apr-2018 16:20 | - | |
|
Maï | 20-Apr-2018 16:20 | - | |
|
Medvěd 009 | 20-Apr-2018 16:20 | - | |
|
Melena | 20-Apr-2018 16:20 | - | |
|
Mescaline Drive | 20-Apr-2018 16:20 | - | |
|
Michael McGloiry | 20-Apr-2018 16:20 | - | |
|
Mikael Nordfors & Mats Wester | 20-Apr-2018 16:20 | - | |
|
Milanese ⁄ Rob Booth | 20-Apr-2018 16:20 | - | |
|
Mince Pye | 20-Apr-2018 16:20 | - | |
|
Minilogue & KAB | 20-Apr-2018 16:20 | - | |
|
Moonshine Still | 20-Apr-2018 16:20 | - | |
|
Mr. Statik | 20-Apr-2018 16:20 | - | |
|
Neal Black & The Healers | 20-Apr-2018 16:20 | - | |
|
Nekby Tsunami | 20-Apr-2018 16:20 | - | |
|
Neversaid | 20-Apr-2018 16:20 | - | |
|
O'Boy Dila & Ortega The Omega | 20-Apr-2018 16:20 | - | |
|
O.H.M. | 20-Apr-2018 16:20 | - | |
|
Ois II Men | 20-Apr-2018 16:20 | - | |
|
One Inch Man | 20-Apr-2018 16:20 | - | |
|
Osmo Ikonen | 20-Apr-2018 16:20 | - | |
|
P.O.X. | 20-Apr-2018 16:20 | - | |
|
Pacific Entertainment | 20-Apr-2018 16:20 | - | |
|
Paco Fernández del Amor | 20-Apr-2018 16:20 | - | |
|
Palolo | 20-Apr-2018 16:20 | - | |
|
Paloma im Blute | 20-Apr-2018 16:20 | - | |
|
Partision | 20-Apr-2018 16:20 | - | |
|
Pastor Fitzner | 20-Apr-2018 16:20 | - | |
|
Patrick Thomas Hawes | 20-Apr-2018 16:20 | - | |
|
Paul Evoskevich & Bill Cunliffe | 20-Apr-2018 16:20 | - | |
|
Paul Humphrey & His Cool Aid Chemists | 20-Apr-2018 16:20 | - | |
|
Pet | 20-Apr-2018 16:20 | - | |
|
Phaginbaum FaNess | 20-Apr-2018 16:20 | - | |
|
Pirkko Mannola & Wyn Hoop | 20-Apr-2018 16:20 | - | |
|
Precious Fathers | 20-Apr-2018 16:20 | - | |
|
Presley Bastards | 20-Apr-2018 16:20 | - | |
|
Profesora | 20-Apr-2018 16:20 | - | |
|
Proskool | 20-Apr-2018 16:20 | - | |
|
Pulselooper | 20-Apr-2018 16:20 | - | |
|
Pussycat Trash | 20-Apr-2018 16:20 | - | |
|
Radio Ethiopia | 20-Apr-2018 16:20 | - | |
|
Raya Yarbrough | 20-Apr-2018 16:20 | - | |
|
Rhona Mitra | 20-Apr-2018 16:20 | - | |
|
Richard Dorfmeister vs. Madrid de los Austrias | 20-Apr-2018 16:20 | - | |
|
Ricky Graham | 20-Apr-2018 16:20 | - | |
|
Robert Belfour | 20-Apr-2018 16:20 | - | |
|
Rocky Denis | 20-Apr-2018 16:20 | - | |
|
Roger Pontare | 20-Apr-2018 16:20 | - | |
|
Roger Shah presents Sunlounger | 20-Apr-2018 16:20 | - | |
|
Rosa Ígnea | 20-Apr-2018 16:20 | - | |
|
Rowland Greenberg | 20-Apr-2018 16:20 | - | |
|
SI Storer | 20-Apr-2018 16:20 | - | |
|
SULFURIC ACID | 20-Apr-2018 16:20 | - | |
|
Second Identity | 20-Apr-2018 16:20 | - | |
|
Second Thought | 20-Apr-2018 16:20 | - | |
|
ShiGGa Shay | 20-Apr-2018 16:20 | - | |
|
Shimm1 | 20-Apr-2018 16:20 | - | |
|
Shy FX & T Power feat. Top Cat | 20-Apr-2018 16:20 | - | |
|
Silent Hill | 20-Apr-2018 16:20 | - | |
|
Smokey Mountain | 20-Apr-2018 16:20 | - | |
|
Spike Marlin and the Thunders | 20-Apr-2018 16:20 | - | |
|
Stones & Holes | 20-Apr-2018 16:20 | - | |
|
Storm and The Balls | 20-Apr-2018 16:20 | - | |
|
Studmuffin | 20-Apr-2018 16:20 | - | |
|
Subspecies | 20-Apr-2018 16:20 | - | |
|
Sugoi | 20-Apr-2018 16:20 | - | |
|
Tangier | 20-Apr-2018 16:20 | - | |
|
Target Nevada | 20-Apr-2018 16:20 | - | |
|
Tears of Destruction | 20-Apr-2018 16:20 | - | |
|
Technicolor | 20-Apr-2018 16:20 | - | |
|
Technological Sun | 20-Apr-2018 16:20 | - | |
|
The Dolls | 20-Apr-2018 16:20 | - | |
|
The Fanatics | 20-Apr-2018 16:20 | - | |
|
The Fishhospital | 20-Apr-2018 16:20 | - | |
|
The Movies | 20-Apr-2018 16:20 | - | |
|
The Music Sounds | 20-Apr-2018 16:20 | - | |
|
The Peasall Sisters | 20-Apr-2018 16:20 | - | |
|
The Rakes | 20-Apr-2018 16:20 | - | |
|
The She Creatures | 20-Apr-2018 16:20 | - | |
|
The Taste of Blood | 20-Apr-2018 16:20 | - | |
|
The Vivs | 20-Apr-2018 16:20 | - | |
|
The Whistlebinkies | 20-Apr-2018 16:20 | - | |
|
Thunderbolt | 20-Apr-2018 16:20 | - | |
|
Tim Hughes & Martyn Layzell | 20-Apr-2018 16:20 | - | |
|
Trackyard | 20-Apr-2018 16:20 | - | |
|
Travudia | 20-Apr-2018 16:20 | - | |
|
Tropes | 20-Apr-2018 16:20 | - | |
|
Troublegum | 20-Apr-2018 16:20 | - | |
|
Vapnet | 20-Apr-2018 16:20 | - | |
|
Vorn Doolette | 20-Apr-2018 16:20 | - | |
|
Werner Niedermeier | 20-Apr-2018 16:20 | - | |
|
WestBam & Superpitcher | 20-Apr-2018 16:20 | - | |
|
Winfield | 20-Apr-2018 16:20 | - | |
|
Xabier Iriondo ⁄ Gianni Mimmo | 20-Apr-2018 16:20 | - | |
|
Xangai & Quinteto da Paraíba | 20-Apr-2018 16:20 | - | |
|
Yan Kuba Saho | 20-Apr-2018 16:20 | - | |
|
Young Livers | 20-Apr-2018 16:20 | - | |
|
annodalleb | 20-Apr-2018 16:20 | - | |
|
blood stain | 20-Apr-2018 16:20 | - | |
|
les petites choses de la vie | 20-Apr-2018 16:20 | - | |
|
安室奈美恵 feat. 川畑要 | 20-Apr-2018 16:20 | - | |
|
蔡孟臻 | 20-Apr-2018 16:20 | - | |
|
高岡亜衣 | 20-Apr-2018 16:20 | - | |